C13H13F3N4O — CID 169110325
3-amino-1-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrazole-4-carboxamide (PubChem CID 169110325) has the molecular formula C13H13F3N4O and a molecular weight of 298.27 g/mol. Its IUPAC name is 3-amino-1-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrazole-4-carboxamide.
| Compound Name | 3-amino-1-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 169110325 |
| Molecular Formula | C13H13F3N4O |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-amino-1-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NCc2ccccc2C(F)(F)F)c(N)n1 |
| InChI | InChI=1S/C13H13F3N4O/c1-20-7-9(11(17)19-20)12(21)18-6-8-4-2-3-5-10(8)13(14,15)16/h2-5,7H,6H2,1H3,(H2,17,19)(H,18,21) |
| InChIKey | RWURRZWRLGBQEH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |