C21H22N2O2S — CID 169112142
benzyl (2R,5S)-2-(1,3-benzothiazol-5-yl)-5-methylpiperidine-1-carboxylate (PubChem CID 169112142) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is benzyl (2R,5S)-2-(1,3-benzothiazol-5-yl)-5-methylpiperidine-1-carboxylate.
| Compound Name | benzyl (2R,5S)-2-(1,3-benzothiazol-5-yl)-5-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 169112142 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | benzyl (2R,5S)-2-(1,3-benzothiazol-5-yl)-5-methylpiperidine-1-carboxylate |
| SMILES | C[C@H]1CC[C@H](c2ccc3scnc3c2)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H22N2O2S/c1-15-7-9-19(17-8-10-20-18(11-17)22-14-26-20)23(12-15)21(24)25-13-16-5-3-2-4-6-16/h2-6,8,10-11,14-15,19H,7,9,12-13H2,1H3/t15-,19+/m0/s1 |
| InChIKey | GRDFVUHJYFRHKG-HNAYVOBHSA-N |
| XLogP | 5.41 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |