C15H20N2S — CID 169112728
2-(1,3,3-trimethylpiperidin-4-yl)-1,3-benzothiazole (PubChem CID 169112728) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 2-(1,3,3-trimethylpiperidin-4-yl)-1,3-benzothiazole.
| Compound Name | 2-(1,3,3-trimethylpiperidin-4-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 169112728 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-(1,3,3-trimethylpiperidin-4-yl)-1,3-benzothiazole |
| SMILES | CN1CCC(c2nc3ccccc3s2)C(C)(C)C1 |
| InChI | InChI=1S/C15H20N2S/c1-15(2)10-17(3)9-8-11(15)14-16-12-6-4-5-7-13(12)18-14/h4-7,11H,8-10H2,1-3H3 |
| InChIKey | RKJAQSDZMFWJFL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |