C16H22F3N3O3 — CID 169114627
2,2,2-trifluoroethyl 2-[(2R,5R)-5-methyl-2-(2-propan-2-ylpyrazol-3-yl)piperidin-1-yl]-2-oxoacetate (PubChem CID 169114627) has the molecular formula C16H22F3N3O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(2R,5R)-5-methyl-2-(2-propan-2-ylpyrazol-3-yl)piperidin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(2R,5R)-5-methyl-2-(2-propan-2-ylpyrazol-3-yl)piperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 169114627 |
| Molecular Formula | C16H22F3N3O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(2R,5R)-5-methyl-2-(2-propan-2-ylpyrazol-3-yl)piperidin-1-yl]-2-oxoacetate |
| SMILES | CC(C)n1nccc1[C@H]1CC[C@@H](C)CN1C(=O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C16H22F3N3O3/c1-10(2)22-13(6-7-20-22)12-5-4-11(3)8-21(12)14(23)15(24)25-9-16(17,18)19/h6-7,10-12H,4-5,8-9H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | UXLCMZQQOQSQEY-VXGBXAGGSA-N |
| XLogP | 2.87 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|