C29H25F5N2O7 — CID 169122647
3-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]-6-[[3-[2-fluoro-4-(trifluoromethyl)phenyl]-7-hydroxyquinolin-4-yl]-hydroxymethyl]benzene-1,2,4,5-tetrol (PubChem CID 169122647) has the molecular formula C29H25F5N2O7 and a molecular weight of 608.52 g/mol. Its IUPAC name is 3-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]-6-[[3-[2-fluoro-4-(trifluoromethyl)phenyl]-7-hydroxyquinolin-4-yl]-hydroxymethyl]benzene-1,2,4,5-tetrol.
| Compound Name | 3-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]-6-[[3-[2-fluoro-4-(trifluoromethyl)phenyl]-7-hydroxyquinolin-4-yl]-hydroxymethyl]benzene-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 169122647 |
| Molecular Formula | C29H25F5N2O7 |
| Molecular Weight | 608.52 g/mol |
| Exact Mass | 608.16 |
| IUPAC Name | 3-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]-6-[[3-[2-fluoro-4-(trifluoromethyl)phenyl]-7-hydroxyquinolin-4-yl]-hydroxymethyl]benzene-1,2,4,5-tetrol |
| SMILES | Oc1ccc2c(C(O)c3c(O)c(O)c(OCCN4CC(CF)C4)c(O)c3O)c(-c3ccc(C(F)(F)F)cc3F)cnc2c1 |
| InChI | InChI=1S/C29H25F5N2O7/c30-9-13-11-36(12-13)5-6-43-28-26(41)24(39)22(25(40)27(28)42)23(38)21-17-4-2-15(37)8-20(17)35-10-18(21)16-3-1-14(7-19(16)31)29(32,33)34/h1-4,7-8,10,13,23,37-42H,5-6,9,11-12H2 |
| InChIKey | UTNDNNIKHHNNSU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|