C29H25ClF4N2O3 — CID 169013083
(5R)-5-[4-[2-[[2-(chloromethyl)-3-fluoropropyl]amino]ethoxy]phenyl]-8-(trifluoromethyl)-5H-chromeno[4,3-c]quinolin-2-ol (PubChem CID 169013083) has the molecular formula C29H25ClF4N2O3 and a molecular weight of 560.98 g/mol. Its IUPAC name is (5R)-5-[4-[2-[[2-(chloromethyl)-3-fluoropropyl]amino]ethoxy]phenyl]-8-(trifluoromethyl)-5H-chromeno[4,3-c]quinolin-2-ol.
| Compound Name | (5R)-5-[4-[2-[[2-(chloromethyl)-3-fluoropropyl]amino]ethoxy]phenyl]-8-(trifluoromethyl)-5H-chromeno[4,3-c]quinolin-2-ol |
|---|---|
| PubChem CID | 169013083 |
| Molecular Formula | C29H25ClF4N2O3 |
| Molecular Weight | 560.98 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | (5R)-5-[4-[2-[[2-(chloromethyl)-3-fluoropropyl]amino]ethoxy]phenyl]-8-(trifluoromethyl)-5H-chromeno[4,3-c]quinolin-2-ol |
| SMILES | Oc1ccc2c3c(cnc2c1)-c1ccc(C(F)(F)F)cc1O[C@@H]3c1ccc(OCCNCC(CF)CCl)cc1 |
| InChI | InChI=1S/C29H25ClF4N2O3/c30-13-17(14-31)15-35-9-10-38-21-5-1-18(2-6-21)28-27-23-8-4-20(37)12-25(23)36-16-24(27)22-7-3-19(29(32,33)34)11-26(22)39-28/h1-8,11-12,16-17,28,35,37H,9-10,13-15H2/t17?,28-/m1/s1 |
| InChIKey | JOLHAZLLGFWORD-BBAYJXMYSA-N |
| XLogP | 6.90 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.98 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|