C30H25F6NO8S3 — CID 15871363
[6-[4-(2-piperidin-1-ylethoxy)phenyl]-9-(trifluoromethylsulfonyloxy)-6H-[1]benzothiolo[3,2-c]chromen-3-yl] trifluoromethanesulfonate (PubChem CID 15871363) has the molecular formula C30H25F6NO8S3 and a molecular weight of 737.72 g/mol. Its IUPAC name is [6-[4-(2-piperidin-1-ylethoxy)phenyl]-9-(trifluoromethylsulfonyloxy)-6H-[1]benzothiolo[3,2-c]chromen-3-yl] trifluoromethanesulfonate.
| Compound Name | [6-[4-(2-piperidin-1-ylethoxy)phenyl]-9-(trifluoromethylsulfonyloxy)-6H-[1]benzothiolo[3,2-c]chromen-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15871363 |
| Molecular Formula | C30H25F6NO8S3 |
| Molecular Weight | 737.72 g/mol |
| Exact Mass | 737.06 |
| IUPAC Name | [6-[4-(2-piperidin-1-ylethoxy)phenyl]-9-(trifluoromethylsulfonyloxy)-6H-[1]benzothiolo[3,2-c]chromen-3-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)OC(c1ccc(OCCN3CCCCC3)cc1)c1c-2sc2cc(OS(=O)(=O)C(F)(F)F)ccc12)C(F)(F)F |
| InChI | InChI=1S/C30H25F6NO8S3/c31-29(32,33)47(38,39)44-20-8-10-22-24(16-20)43-27(18-4-6-19(7-5-18)42-15-14-37-12-2-1-3-13-37)26-23-11-9-21(17-25(23)46-28(22)26)45-48(40,41)30(34,35)36/h4-11,16-17,27H,1-3,12-15H2 |
| InChIKey | MXXMEMOOCHWSPD-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.72 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|