C27H24F3NO5 — CID 169013068
(5R)-5-[4-(2,2-dimethoxyethoxy)phenyl]-8-(trifluoromethyl)-11,12-dihydro-5H-chromeno[4,3-c]quinolin-2-ol (PubChem CID 169013068) has the molecular formula C27H24F3NO5 and a molecular weight of 499.49 g/mol. Its IUPAC name is (5R)-5-[4-(2,2-dimethoxyethoxy)phenyl]-8-(trifluoromethyl)-11,12-dihydro-5H-chromeno[4,3-c]quinolin-2-ol.
| Compound Name | (5R)-5-[4-(2,2-dimethoxyethoxy)phenyl]-8-(trifluoromethyl)-11,12-dihydro-5H-chromeno[4,3-c]quinolin-2-ol |
|---|---|
| PubChem CID | 169013068 |
| Molecular Formula | C27H24F3NO5 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | (5R)-5-[4-(2,2-dimethoxyethoxy)phenyl]-8-(trifluoromethyl)-11,12-dihydro-5H-chromeno[4,3-c]quinolin-2-ol |
| SMILES | COC(COc1ccc([C@H]2Oc3cc(C(F)(F)F)ccc3C3=C2c2ccc(O)cc2NC3)cc1)OC |
| InChI | InChI=1S/C27H24F3NO5/c1-33-24(34-2)14-35-18-7-3-15(4-8-18)26-25-20-10-6-17(32)12-22(20)31-13-21(25)19-9-5-16(27(28,29)30)11-23(19)36-26/h3-12,24,26,31-32H,13-14H2,1-2H3/t26-/m1/s1 |
| InChIKey | RFJLAFAKXOBSLV-AREMUKBSSA-N |
| XLogP | 5.88 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|