C28H26F3NO4 — CID 170079616
(5R)-5-[4-(2-ethoxypropoxy)phenyl]-8-(trifluoromethyl)-11,12-dihydro-5H-chromeno[4,3-c]quinolin-2-ol (PubChem CID 170079616) has the molecular formula C28H26F3NO4 and a molecular weight of 497.51 g/mol. Its IUPAC name is (5R)-5-[4-(2-ethoxypropoxy)phenyl]-8-(trifluoromethyl)-11,12-dihydro-5H-chromeno[4,3-c]quinolin-2-ol.
| Compound Name | (5R)-5-[4-(2-ethoxypropoxy)phenyl]-8-(trifluoromethyl)-11,12-dihydro-5H-chromeno[4,3-c]quinolin-2-ol |
|---|---|
| PubChem CID | 170079616 |
| Molecular Formula | C28H26F3NO4 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (5R)-5-[4-(2-ethoxypropoxy)phenyl]-8-(trifluoromethyl)-11,12-dihydro-5H-chromeno[4,3-c]quinolin-2-ol |
| SMILES | CCOC(C)COc1ccc([C@H]2Oc3cc(C(F)(F)F)ccc3C3=C2c2ccc(O)cc2NC3)cc1 |
| InChI | InChI=1S/C28H26F3NO4/c1-3-34-16(2)15-35-20-8-4-17(5-9-20)27-26-22-11-7-19(33)13-24(22)32-14-23(26)21-10-6-18(28(29,30)31)12-25(21)36-27/h4-13,16,27,32-33H,3,14-15H2,1-2H3/t16?,27-/m1/s1 |
| InChIKey | MJWRLYYRNDPVRT-GDALGIGOSA-N |
| XLogP | 6.68 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|