C17H11F4NO2 — CID 174242071
3-[2-fluoro-4-(trifluoromethyl)phenyl]-4-(hydroxymethyl)quinolin-7-ol (PubChem CID 174242071) has the molecular formula C17H11F4NO2 and a molecular weight of 337.27 g/mol. Its IUPAC name is 3-[2-fluoro-4-(trifluoromethyl)phenyl]-4-(hydroxymethyl)quinolin-7-ol.
| Compound Name | 3-[2-fluoro-4-(trifluoromethyl)phenyl]-4-(hydroxymethyl)quinolin-7-ol |
|---|---|
| PubChem CID | 174242071 |
| Molecular Formula | C17H11F4NO2 |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-[2-fluoro-4-(trifluoromethyl)phenyl]-4-(hydroxymethyl)quinolin-7-ol |
| SMILES | OCc1c(-c2ccc(C(F)(F)F)cc2F)cnc2cc(O)ccc12 |
| InChI | InChI=1S/C17H11F4NO2/c18-15-5-9(17(19,20)21)1-3-11(15)13-7-22-16-6-10(24)2-4-12(16)14(13)8-23/h1-7,23-24H,8H2 |
| InChIKey | XLZQUMZSFHWOJM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |