C17H27ClN2O — CID 169122745
5-chloro-2-[(2,3-dimethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]phenol;ethane (PubChem CID 169122745) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 5-chloro-2-[(2,3-dimethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]phenol;ethane.
| Compound Name | 5-chloro-2-[(2,3-dimethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]phenol;ethane |
|---|---|
| PubChem CID | 169122745 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 5-chloro-2-[(2,3-dimethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]phenol;ethane |
| SMILES | CC.CC1C2CN(Cc3ccc(Cl)cc3O)CC2CN1C |
| InChI | InChI=1S/C15H21ClN2O.C2H6/c1-10-14-9-18(8-12(14)6-17(10)2)7-11-3-4-13(16)5-15(11)19;1-2/h3-5,10,12,14,19H,6-9H2,1-2H3;1-2H3 |
| InChIKey | GASFCUJRYAJLCO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|