C15H21ClN2O — CID 169123334
2-[[(3S,3aS,6aR)-2,3-dimethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-5-chlorophenol (PubChem CID 169123334) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is 2-[[(3S,3aS,6aR)-2,3-dimethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-5-chlorophenol.
| Compound Name | 2-[[(3S,3aS,6aR)-2,3-dimethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-5-chlorophenol |
|---|---|
| PubChem CID | 169123334 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-[[(3S,3aS,6aR)-2,3-dimethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-5-chlorophenol |
| SMILES | C[C@H]1[C@@H]2CN(Cc3ccc(Cl)cc3O)C[C@@H]2CN1C |
| InChI | InChI=1S/C15H21ClN2O/c1-10-14-9-18(8-12(14)6-17(10)2)7-11-3-4-13(16)5-15(11)19/h3-5,10,12,14,19H,6-9H2,1-2H3/t10-,12-,14-/m0/s1 |
| InChIKey | VTTPDWROUWMJAQ-JKOKRWQUSA-N |
| XLogP | 2.43 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|