C11H15N3ORb- — CID 169125707
carbanide;N-methyl-5,6,7,8-tetrahydro-1,6-naphthyridin-7-ide-3-carboxamide;rubidium(1+) (PubChem CID 169125707) has the molecular formula C11H15N3ORb- and a molecular weight of 290.73 g/mol. Its IUPAC name is carbanide;N-methyl-5,6,7,8-tetrahydro-1,6-naphthyridin-7-ide-3-carboxamide;rubidium(1+).
| Compound Name | carbanide;N-methyl-5,6,7,8-tetrahydro-1,6-naphthyridin-7-ide-3-carboxamide;rubidium(1+) |
|---|---|
| PubChem CID | 169125707 |
| Molecular Formula | C11H15N3ORb- |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | carbanide;N-methyl-5,6,7,8-tetrahydro-1,6-naphthyridin-7-ide-3-carboxamide;rubidium(1+) |
| SMILES | CNC(=O)c1cnc2c(c1)CN[CH-]C2.[CH3-].[Rb+] |
| InChI | InChI=1S/C10H12N3O.CH3.Rb/c1-11-10(14)8-4-7-5-12-3-2-9(7)13-6-8;;/h3-4,6,12H,2,5H2,1H3,(H,11,14);1H3;/q2*-1;+1 |
| InChIKey | DBBMBIJLVRPKDC-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|