C14H20N4O — CID 70227123
N-(N'-ethylcarbamimidoyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxamide (PubChem CID 70227123) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(N'-ethylcarbamimidoyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxamide.
| Compound Name | N-(N'-ethylcarbamimidoyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 70227123 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-(N'-ethylcarbamimidoyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxamide |
| SMILES | CC/N=C(\N)NC(=O)c1cnc2c(c1)CCCCC2 |
| InChI | InChI=1S/C14H20N4O/c1-2-16-14(15)18-13(19)11-8-10-6-4-3-5-7-12(10)17-9-11/h8-9H,2-7H2,1H3,(H3,15,16,18,19) |
| InChIKey | KALYJDSOEWGPHF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|