C11H25N — CID 169125880
ethane;1-ethyl-N,N,3-trimethylcyclobutan-1-amine (PubChem CID 169125880) has the molecular formula C11H25N and a molecular weight of 171.33 g/mol. Its IUPAC name is ethane;1-ethyl-N,N,3-trimethylcyclobutan-1-amine.
| Compound Name | ethane;1-ethyl-N,N,3-trimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 169125880 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | ethane;1-ethyl-N,N,3-trimethylcyclobutan-1-amine |
| SMILES | CC.CCC1(N(C)C)CC(C)C1 |
| InChI | InChI=1S/C9H19N.C2H6/c1-5-9(10(3)4)6-8(2)7-9;1-2/h8H,5-7H2,1-4H3;1-2H3 |
| InChIKey | GAVLQMPWMPQIHN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |