C20H22N4O2S2 — CID 169128392
5-[[(3aR,6aS)-5-(1-methylimidazol-2-yl)sulfanyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]isoquinoline (PubChem CID 169128392) has the molecular formula C20H22N4O2S2 and a molecular weight of 414.56 g/mol. Its IUPAC name is 5-[[(3aR,6aS)-5-(1-methylimidazol-2-yl)sulfanyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]isoquinoline.
| Compound Name | 5-[[(3aR,6aS)-5-(1-methylimidazol-2-yl)sulfanyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]isoquinoline |
|---|---|
| PubChem CID | 169128392 |
| Molecular Formula | C20H22N4O2S2 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 5-[[(3aR,6aS)-5-(1-methylimidazol-2-yl)sulfanyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]isoquinoline |
| SMILES | Cn1ccnc1SC1C[C@@H]2CN(S(=O)(=O)c3cccc4cnccc34)C[C@@H]2C1 |
| InChI | InChI=1S/C20H22N4O2S2/c1-23-8-7-22-20(23)27-17-9-15-12-24(13-16(15)10-17)28(25,26)19-4-2-3-14-11-21-6-5-18(14)19/h2-8,11,15-17H,9-10,12-13H2,1H3/t15-,16+,17? |
| InChIKey | ZVVLAFCSLMWZQD-SJPCQFCGSA-N |
| XLogP | 3.16 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |