C37H34F2N4O2S — CID 169134513
1-[7-[7-(2,4-difluoro-6-propan-2-yloxyphenyl)-4-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)thieno[3,2-c]pyridin-6-yl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one (PubChem CID 169134513) has the molecular formula C37H34F2N4O2S and a molecular weight of 636.77 g/mol. Its IUPAC name is 1-[7-[7-(2,4-difluoro-6-propan-2-yloxyphenyl)-4-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)thieno[3,2-c]pyridin-6-yl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[7-(2,4-difluoro-6-propan-2-yloxyphenyl)-4-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)thieno[3,2-c]pyridin-6-yl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169134513 |
| Molecular Formula | C37H34F2N4O2S |
| Molecular Weight | 636.77 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | 1-[7-[7-(2,4-difluoro-6-propan-2-yloxyphenyl)-4-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)thieno[3,2-c]pyridin-6-yl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2ccc(-c3nc(-c4cnc5c(c4)CN(C)CC5)c4ccsc4c3-c3c(F)cc(F)cc3OC(C)C)cc2C1 |
| InChI | InChI=1S/C37H34F2N4O2S/c1-5-32(44)43-12-8-22-6-7-23(14-25(22)20-43)36-34(33-29(39)16-27(38)17-31(33)45-21(2)3)37-28(10-13-46-37)35(41-36)24-15-26-19-42(4)11-9-30(26)40-18-24/h5-7,10,13-18,21H,1,8-9,11-12,19-20H2,2-4H3 |
| InChIKey | UVSDZPBWMWAREF-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.77 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|