C38H40FN3O3S — CID 169134850
N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]-3,3-dimethylbutanamide (PubChem CID 169134850) has the molecular formula C38H40FN3O3S and a molecular weight of 637.82 g/mol. Its IUPAC name is N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]-3,3-dimethylbutanamide.
| Compound Name | N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 169134850 |
| Molecular Formula | C38H40FN3O3S |
| Molecular Weight | 637.82 g/mol |
| Exact Mass | 637.28 |
| IUPAC Name | N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]-3,3-dimethylbutanamide |
| SMILES | COCCOc1cc(F)ccc1-c1c(-c2cccc(CNC(=O)CC(C)(C)C)c2)nc(-c2ccc3c(c2)CCNC3)c2ccsc12 |
| InChI | InChI=1S/C38H40FN3O3S/c1-38(2,3)21-33(43)41-22-24-6-5-7-26(18-24)36-34(30-11-10-29(39)20-32(30)45-16-15-44-4)37-31(13-17-46-37)35(42-36)27-8-9-28-23-40-14-12-25(28)19-27/h5-11,13,17-20,40H,12,14-16,21-23H2,1-4H3,(H,41,43) |
| InChIKey | OSFVVKOJLWGZKE-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.82 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|