C33H35FN4O2S — CID 169135462
6-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridine (PubChem CID 169135462) has the molecular formula C33H35FN4O2S and a molecular weight of 570.73 g/mol. Its IUPAC name is 6-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridine.
| Compound Name | 6-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 169135462 |
| Molecular Formula | C33H35FN4O2S |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 6-[1-(2,2-dimethylpropyl)pyrazol-4-yl]-7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridine |
| SMILES | COCCOc1cc(F)ccc1-c1c(-c2cnn(CC(C)(C)C)c2)nc(-c2ccc3c(c2)CCNC3)c2ccsc12 |
| InChI | InChI=1S/C33H35FN4O2S/c1-33(2,3)20-38-19-24(18-36-38)31-29(26-8-7-25(34)16-28(26)40-13-12-39-4)32-27(10-14-41-32)30(37-31)22-5-6-23-17-35-11-9-21(23)15-22/h5-8,10,14-16,18-19,35H,9,11-13,17,20H2,1-4H3 |
| InChIKey | NLECVRADPCHQKM-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|