C14H19ClN4OS — CID 169137643
N-[(Z)-[2-(2-chlorospiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl)-2-iminoethylidene]amino]methanamine (PubChem CID 169137643) has the molecular formula C14H19ClN4OS and a molecular weight of 326.85 g/mol. Its IUPAC name is N-[(Z)-[2-(2-chlorospiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl)-2-iminoethylidene]amino]methanamine.
| Compound Name | N-[(Z)-[2-(2-chlorospiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl)-2-iminoethylidene]amino]methanamine |
|---|---|
| PubChem CID | 169137643 |
| Molecular Formula | C14H19ClN4OS |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[(Z)-[2-(2-chlorospiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl)-2-iminoethylidene]amino]methanamine |
| SMILES | [H]/N=C(\C=N/NC)C1CC2(CCN1)OCCc1cc(Cl)sc12 |
| InChI | InChI=1S/C14H19ClN4OS/c1-17-19-8-10(16)11-7-14(3-4-18-11)13-9(2-5-20-14)6-12(15)21-13/h6,8,11,16-18H,2-5,7H2,1H3/b16-10+,19-8- |
| InChIKey | UNGABVCRBKGUSM-KCSWZTMLSA-N |
| XLogP | 2.15 |
| TPSA | 69.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|