C15H21ClN4OS — CID 170657754
(2Z)-2-[(2'S,6'R)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-2-hydrazinylidene-N-methylethanimine (PubChem CID 170657754) has the molecular formula C15H21ClN4OS and a molecular weight of 340.88 g/mol. Its IUPAC name is (2Z)-2-[(2'S,6'R)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-2-hydrazinylidene-N-methylethanimine.
| Compound Name | (2Z)-2-[(2'S,6'R)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-2-hydrazinylidene-N-methylethanimine |
|---|---|
| PubChem CID | 170657754 |
| Molecular Formula | C15H21ClN4OS |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (2Z)-2-[(2'S,6'R)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-2-hydrazinylidene-N-methylethanimine |
| SMILES | C/N=C/C(=N\N)[C@@H]1CC2(C[C@@H](C)N1)OCCc1cc(Cl)sc12 |
| InChI | InChI=1S/C15H21ClN4OS/c1-9-6-15(7-11(19-9)12(20-17)8-18-2)14-10(3-4-21-15)5-13(16)22-14/h5,8-9,11,19H,3-4,6-7,17H2,1-2H3/b18-8+,20-12+/t9-,11+,15?/m1/s1 |
| InChIKey | CVNDTRWUOHSBRR-HIYWXJGASA-N |
| XLogP | 2.33 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|