C17H26N4OS — CID 165024064
2-[(2'S,6'S)-2-ethyl-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-2-hydrazinylidene-N-methylethanimine (PubChem CID 165024064) has the molecular formula C17H26N4OS and a molecular weight of 334.49 g/mol. Its IUPAC name is 2-[(2'S,6'S)-2-ethyl-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-2-hydrazinylidene-N-methylethanimine.
| Compound Name | 2-[(2'S,6'S)-2-ethyl-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-2-hydrazinylidene-N-methylethanimine |
|---|---|
| PubChem CID | 165024064 |
| Molecular Formula | C17H26N4OS |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[(2'S,6'S)-2-ethyl-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-2-hydrazinylidene-N-methylethanimine |
| SMILES | CCc1cc2c(s1)C1(C[C@@H](C(/C=N/C)=NN)N[C@@H](C)C1)OCC2 |
| InChI | InChI=1S/C17H26N4OS/c1-4-13-7-12-5-6-22-17(16(12)23-13)8-11(2)20-14(9-17)15(21-18)10-19-3/h7,10-11,14,20H,4-6,8-9,18H2,1-3H3/b19-10+,21-15?/t11-,14-,17?/m0/s1 |
| InChIKey | ZPEBZLWAYWPDFW-ZHKDXVSKSA-N |
| XLogP | 2.23 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|