C18H26ClN5 — CID 168912698
(2Z)-2-[(6'S)-6-chloro-2,6'-dimethylspiro[3,4-dihydroisoquinoline-1,4'-piperidine]-2'-yl]-2-hydrazinylidene-N-methylethanimine (PubChem CID 168912698) has the molecular formula C18H26ClN5 and a molecular weight of 347.89 g/mol. Its IUPAC name is (2Z)-2-[(6'S)-6-chloro-2,6'-dimethylspiro[3,4-dihydroisoquinoline-1,4'-piperidine]-2'-yl]-2-hydrazinylidene-N-methylethanimine.
| Compound Name | (2Z)-2-[(6'S)-6-chloro-2,6'-dimethylspiro[3,4-dihydroisoquinoline-1,4'-piperidine]-2'-yl]-2-hydrazinylidene-N-methylethanimine |
|---|---|
| PubChem CID | 168912698 |
| Molecular Formula | C18H26ClN5 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (2Z)-2-[(6'S)-6-chloro-2,6'-dimethylspiro[3,4-dihydroisoquinoline-1,4'-piperidine]-2'-yl]-2-hydrazinylidene-N-methylethanimine |
| SMILES | C/N=C/C(=N\N)C1CC2(C[C@H](C)N1)c1ccc(Cl)cc1CCN2C |
| InChI | InChI=1S/C18H26ClN5/c1-12-9-18(10-16(22-12)17(23-20)11-21-2)15-5-4-14(19)8-13(15)6-7-24(18)3/h4-5,8,11-12,16,22H,6-7,9-10,20H2,1-3H3/b21-11+,23-17+/t12-,16?,18?/m0/s1 |
| InChIKey | HBNQZJXPNIARGU-ZYKKTJAFSA-N |
| XLogP | 2.18 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|