C22H28ClN3O2 — CID 169137795
N-[4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-2-(dimethylamino)phenyl]-N-methylformamide (PubChem CID 169137795) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is N-[4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-2-(dimethylamino)phenyl]-N-methylformamide.
| Compound Name | N-[4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-2-(dimethylamino)phenyl]-N-methylformamide |
|---|---|
| PubChem CID | 169137795 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-2-(dimethylamino)phenyl]-N-methylformamide |
| SMILES | CN(C)c1cc(CN2CCC(O)(c3ccc(Cl)cc3)CC2)ccc1N(C)C=O |
| InChI | InChI=1S/C22H28ClN3O2/c1-24(2)21-14-17(4-9-20(21)25(3)16-27)15-26-12-10-22(28,11-13-26)18-5-7-19(23)8-6-18/h4-9,14,16,28H,10-13,15H2,1-3H3 |
| InChIKey | HMOBEILCJFRMAD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|