C22H28ClNO4S — CID 169140308
(2'S,4R,7R)-2-chloro-2'-ethyl-1'-[[3-(2-hydroxyethoxy)phenyl]methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol (PubChem CID 169140308) has the molecular formula C22H28ClNO4S and a molecular weight of 437.99 g/mol. Its IUPAC name is (2'S,4R,7R)-2-chloro-2'-ethyl-1'-[[3-(2-hydroxyethoxy)phenyl]methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol.
| Compound Name | (2'S,4R,7R)-2-chloro-2'-ethyl-1'-[[3-(2-hydroxyethoxy)phenyl]methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol |
|---|---|
| PubChem CID | 169140308 |
| Molecular Formula | C22H28ClNO4S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (2'S,4R,7R)-2-chloro-2'-ethyl-1'-[[3-(2-hydroxyethoxy)phenyl]methyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol |
| SMILES | CC[C@H]1C[C@@]2(CCN1Cc1cccc(OCCO)c1)OC[C@H](O)c1cc(Cl)sc12 |
| InChI | InChI=1S/C22H28ClNO4S/c1-2-16-12-22(21-18(11-20(23)29-21)19(26)14-28-22)6-7-24(16)13-15-4-3-5-17(10-15)27-9-8-25/h3-5,10-11,16,19,25-26H,2,6-9,12-14H2,1H3/t16-,19-,22+/m0/s1 |
| InChIKey | YFKARBZCZWSYAO-XWFZLUIHSA-N |
| XLogP | 4.11 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |