C12H21N — CID 169142127
ethane;N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]prop-2-en-1-imine (PubChem CID 169142127) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is ethane;N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]prop-2-en-1-imine.
| Compound Name | ethane;N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 169142127 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | ethane;N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C=C(\C=C)C(C)C.CC |
| InChI | InChI=1S/C10H15N.C2H6/c1-5-7-11-8-10(6-2)9(3)4;1-2/h5-9H,1-2H2,3-4H3;1-2H3/b10-8+,11-7+; |
| InChIKey | OCMGJOKASWOKFG-BQEIIQHISA-N |
| XLogP | 4.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|