C12H19F3O — CID 169142514
(3E)-2,3-dimethyl-5-(trifluoromethoxymethyl)hexa-1,3,5-triene;ethane (PubChem CID 169142514) has the molecular formula C12H19F3O and a molecular weight of 236.28 g/mol. Its IUPAC name is (3E)-2,3-dimethyl-5-(trifluoromethoxymethyl)hexa-1,3,5-triene;ethane.
| Compound Name | (3E)-2,3-dimethyl-5-(trifluoromethoxymethyl)hexa-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 169142514 |
| Molecular Formula | C12H19F3O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (3E)-2,3-dimethyl-5-(trifluoromethoxymethyl)hexa-1,3,5-triene;ethane |
| SMILES | C=C(/C=C(\C)C(=C)C)COC(F)(F)F.CC |
| InChI | InChI=1S/C10H13F3O.C2H6/c1-7(2)9(4)5-8(3)6-14-10(11,12)13;1-2/h5H,1,3,6H2,2,4H3;1-2H3/b9-5+; |
| InChIKey | YSTZEMYNHGOPKO-SZKNIZGXSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|