C25H21ClN2O2S2 — CID 169144935
N-[3-chloro-5-(methylsulfanylamino)phenyl]-4-(2-phenylmethoxyphenyl)thiophene-2-carboxamide (PubChem CID 169144935) has the molecular formula C25H21ClN2O2S2 and a molecular weight of 481.04 g/mol. Its IUPAC name is N-[3-chloro-5-(methylsulfanylamino)phenyl]-4-(2-phenylmethoxyphenyl)thiophene-2-carboxamide.
| Compound Name | N-[3-chloro-5-(methylsulfanylamino)phenyl]-4-(2-phenylmethoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 169144935 |
| Molecular Formula | C25H21ClN2O2S2 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | N-[3-chloro-5-(methylsulfanylamino)phenyl]-4-(2-phenylmethoxyphenyl)thiophene-2-carboxamide |
| SMILES | CSNc1cc(Cl)cc(NC(=O)c2cc(-c3ccccc3OCc3ccccc3)cs2)c1 |
| InChI | InChI=1S/C25H21ClN2O2S2/c1-31-28-21-13-19(26)12-20(14-21)27-25(29)24-11-18(16-32-24)22-9-5-6-10-23(22)30-15-17-7-3-2-4-8-17/h2-14,16,28H,15H2,1H3,(H,27,29) |
| InChIKey | UYFDHMDDCKDZTQ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|