C16H14N4OS2 — CID 169152096
N-[3-(methylsulfanylamino)phenyl]-4-pyrimidin-5-ylthiophene-2-carboxamide (PubChem CID 169152096) has the molecular formula C16H14N4OS2 and a molecular weight of 342.45 g/mol. Its IUPAC name is N-[3-(methylsulfanylamino)phenyl]-4-pyrimidin-5-ylthiophene-2-carboxamide.
| Compound Name | N-[3-(methylsulfanylamino)phenyl]-4-pyrimidin-5-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 169152096 |
| Molecular Formula | C16H14N4OS2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | N-[3-(methylsulfanylamino)phenyl]-4-pyrimidin-5-ylthiophene-2-carboxamide |
| SMILES | CSNc1cccc(NC(=O)c2cc(-c3cncnc3)cs2)c1 |
| InChI | InChI=1S/C16H14N4OS2/c1-22-20-14-4-2-3-13(6-14)19-16(21)15-5-11(9-23-15)12-7-17-10-18-8-12/h2-10,20H,1H3,(H,19,21) |
| InChIKey | DZCFGGKRZSYUBZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|