C24H31N3O2S2Si — CID 174102870
N-[3-[[N-[tert-butyl(dimethyl)silyl]-S-methylsulfonimidoyl]amino]phenyl]-4-phenylthiophene-2-carboxamide (PubChem CID 174102870) has the molecular formula C24H31N3O2S2Si and a molecular weight of 485.75 g/mol. Its IUPAC name is N-[3-[[N-[tert-butyl(dimethyl)silyl]-S-methylsulfonimidoyl]amino]phenyl]-4-phenylthiophene-2-carboxamide.
| Compound Name | N-[3-[[N-[tert-butyl(dimethyl)silyl]-S-methylsulfonimidoyl]amino]phenyl]-4-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 174102870 |
| Molecular Formula | C24H31N3O2S2Si |
| Molecular Weight | 485.75 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N-[3-[[N-[tert-butyl(dimethyl)silyl]-S-methylsulfonimidoyl]amino]phenyl]-4-phenylthiophene-2-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)N=S(C)(=O)Nc1cccc(NC(=O)c2cc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C24H31N3O2S2Si/c1-24(2,3)32(5,6)27-31(4,29)26-21-14-10-13-20(16-21)25-23(28)22-15-19(17-30-22)18-11-8-7-9-12-18/h7-17H,1-6H3,(H,25,28)(H,26,27,29) |
| InChIKey | NAFGYOTXVDSMSV-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.75 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|