C18H15IN2O3S2 — CID 169144914
N-[3-iodo-5-(methanesulfonamido)phenyl]-4-phenylthiophene-2-carboxamide (PubChem CID 169144914) has the molecular formula C18H15IN2O3S2 and a molecular weight of 498.37 g/mol. Its IUPAC name is N-[3-iodo-5-(methanesulfonamido)phenyl]-4-phenylthiophene-2-carboxamide.
| Compound Name | N-[3-iodo-5-(methanesulfonamido)phenyl]-4-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 169144914 |
| Molecular Formula | C18H15IN2O3S2 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 497.96 |
| IUPAC Name | N-[3-iodo-5-(methanesulfonamido)phenyl]-4-phenylthiophene-2-carboxamide |
| SMILES | CS(=O)(=O)Nc1cc(I)cc(NC(=O)c2cc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C18H15IN2O3S2/c1-26(23,24)21-16-9-14(19)8-15(10-16)20-18(22)17-7-13(11-25-17)12-5-3-2-4-6-12/h2-11,21H,1H3,(H,20,22) |
| InChIKey | TXMRYJBUNSQREL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|