C19H16N2O4S2 — CID 169152227
N-[3-formyl-5-(methanesulfonamido)phenyl]-4-phenylthiophene-2-carboxamide (PubChem CID 169152227) has the molecular formula C19H16N2O4S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[3-formyl-5-(methanesulfonamido)phenyl]-4-phenylthiophene-2-carboxamide.
| Compound Name | N-[3-formyl-5-(methanesulfonamido)phenyl]-4-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 169152227 |
| Molecular Formula | C19H16N2O4S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-[3-formyl-5-(methanesulfonamido)phenyl]-4-phenylthiophene-2-carboxamide |
| SMILES | CS(=O)(=O)Nc1cc(C=O)cc(NC(=O)c2cc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C19H16N2O4S2/c1-27(24,25)21-17-8-13(11-22)7-16(10-17)20-19(23)18-9-15(12-26-18)14-5-3-2-4-6-14/h2-12,21H,1H3,(H,20,23) |
| InChIKey | SRERJZGQZBKQPW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|