C18H15N3O3S2 — CID 169152346
2-[5-[[3-(methylsulfanylamino)phenyl]carbamoyl]thiophen-3-yl]pyridine-4-carboxylic acid (PubChem CID 169152346) has the molecular formula C18H15N3O3S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-[5-[[3-(methylsulfanylamino)phenyl]carbamoyl]thiophen-3-yl]pyridine-4-carboxylic acid.
| Compound Name | 2-[5-[[3-(methylsulfanylamino)phenyl]carbamoyl]thiophen-3-yl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 169152346 |
| Molecular Formula | C18H15N3O3S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-[5-[[3-(methylsulfanylamino)phenyl]carbamoyl]thiophen-3-yl]pyridine-4-carboxylic acid |
| SMILES | CSNc1cccc(NC(=O)c2cc(-c3cc(C(=O)O)ccn3)cs2)c1 |
| InChI | InChI=1S/C18H15N3O3S2/c1-25-21-14-4-2-3-13(9-14)20-17(22)16-8-12(10-26-16)15-7-11(18(23)24)5-6-19-15/h2-10,21H,1H3,(H,20,22)(H,23,24) |
| InChIKey | ZYVIOCWIOSLEGL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|