C20H18ClN3O3S2 — CID 169152165
4-N-(3-chloro-5-methoxyphenyl)-2-N-[3-(methylsulfanylamino)phenyl]thiophene-2,4-dicarboxamide (PubChem CID 169152165) has the molecular formula C20H18ClN3O3S2 and a molecular weight of 447.97 g/mol. Its IUPAC name is 4-N-(3-chloro-5-methoxyphenyl)-2-N-[3-(methylsulfanylamino)phenyl]thiophene-2,4-dicarboxamide.
| Compound Name | 4-N-(3-chloro-5-methoxyphenyl)-2-N-[3-(methylsulfanylamino)phenyl]thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 169152165 |
| Molecular Formula | C20H18ClN3O3S2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 4-N-(3-chloro-5-methoxyphenyl)-2-N-[3-(methylsulfanylamino)phenyl]thiophene-2,4-dicarboxamide |
| SMILES | COc1cc(Cl)cc(NC(=O)c2csc(C(=O)Nc3cccc(NSC)c3)c2)c1 |
| InChI | InChI=1S/C20H18ClN3O3S2/c1-27-17-8-13(21)7-16(10-17)23-19(25)12-6-18(29-11-12)20(26)22-14-4-3-5-15(9-14)24-28-2/h3-11,24H,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | GEGQOQVAMBPQLP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|