C12H14NO3STl — CID 169145080
[2-[2-(benzenesulfonyl)acetyl]pyrrolidin-1-yl]thallium (PubChem CID 169145080) has the molecular formula C12H14NO3STl and a molecular weight of 456.70 g/mol. Its IUPAC name is [2-[2-(benzenesulfonyl)acetyl]pyrrolidin-1-yl]thallium.
| Compound Name | [2-[2-(benzenesulfonyl)acetyl]pyrrolidin-1-yl]thallium |
|---|---|
| PubChem CID | 169145080 |
| Molecular Formula | C12H14NO3STl |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | [2-[2-(benzenesulfonyl)acetyl]pyrrolidin-1-yl]thallium |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)C1CCCN1[Tl] |
| InChI | InChI=1S/C12H14NO3S.Tl/c14-12(11-7-4-8-13-11)9-17(15,16)10-5-2-1-3-6-10;/h1-3,5-6,11H,4,7-9H2;/q-1;+1 |
| InChIKey | JMPLFMBEWLRVQU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |