C15H21F — CID 169145598
4-fluoro-3-propan-2-yl-3-propyl-1,2-dihydroindene (PubChem CID 169145598) has the molecular formula C15H21F and a molecular weight of 220.33 g/mol. Its IUPAC name is 4-fluoro-3-propan-2-yl-3-propyl-1,2-dihydroindene.
| Compound Name | 4-fluoro-3-propan-2-yl-3-propyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 169145598 |
| Molecular Formula | C15H21F |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-fluoro-3-propan-2-yl-3-propyl-1,2-dihydroindene |
| SMILES | CCCC1(C(C)C)CCc2cccc(F)c21 |
| InChI | InChI=1S/C15H21F/c1-4-9-15(11(2)3)10-8-12-6-5-7-13(16)14(12)15/h5-7,11H,4,8-10H2,1-3H3 |
| InChIKey | LLUURLPIAQQZAM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |