C13H16F2 — CID 169145613
4,7-difluoro-3-methyl-3-propan-2-yl-1,2-dihydroindene (PubChem CID 169145613) has the molecular formula C13H16F2 and a molecular weight of 210.27 g/mol. Its IUPAC name is 4,7-difluoro-3-methyl-3-propan-2-yl-1,2-dihydroindene.
| Compound Name | 4,7-difluoro-3-methyl-3-propan-2-yl-1,2-dihydroindene |
|---|---|
| PubChem CID | 169145613 |
| Molecular Formula | C13H16F2 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 4,7-difluoro-3-methyl-3-propan-2-yl-1,2-dihydroindene |
| SMILES | CC(C)C1(C)CCc2c(F)ccc(F)c21 |
| InChI | InChI=1S/C13H16F2/c1-8(2)13(3)7-6-9-10(14)4-5-11(15)12(9)13/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | RHYOWMOWPOVTPO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |