C21H23Cl2IN4O — CID 169147811
1-(6,7-dichloro-5-methyl-9-pyrimidin-5-yl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl)-4-(methylidene-λ3-iodanyl)butan-1-one (PubChem CID 169147811) has the molecular formula C21H23Cl2IN4O and a molecular weight of 545.25 g/mol. Its IUPAC name is 1-(6,7-dichloro-5-methyl-9-pyrimidin-5-yl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl)-4-(methylidene-λ3-iodanyl)butan-1-one.
| Compound Name | 1-(6,7-dichloro-5-methyl-9-pyrimidin-5-yl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl)-4-(methylidene-λ3-iodanyl)butan-1-one |
|---|---|
| PubChem CID | 169147811 |
| Molecular Formula | C21H23Cl2IN4O |
| Molecular Weight | 545.25 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | 1-(6,7-dichloro-5-methyl-9-pyrimidin-5-yl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl)-4-(methylidene-λ3-iodanyl)butan-1-one |
| SMILES | C=ICCCC(=O)N1CCC2C(C1)c1c(-c3cncnc3)cc(Cl)c(Cl)c1N2C |
| InChI | InChI=1S/C21H23Cl2IN4O/c1-24-6-3-4-18(29)28-7-5-17-15(11-28)19-14(13-9-25-12-26-10-13)8-16(22)20(23)21(19)27(17)2/h8-10,12,15,17H,1,3-7,11H2,2H3 |
| InChIKey | IGIVIAZZNWDDMO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.25 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|