C20H23Cl2IN4O — CID 169147886
1-[6,7-dichloro-5-methyl-9-(1-methylpyrazol-3-yl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]-4-iodobutan-1-one (PubChem CID 169147886) has the molecular formula C20H23Cl2IN4O and a molecular weight of 533.24 g/mol. Its IUPAC name is 1-[6,7-dichloro-5-methyl-9-(1-methylpyrazol-3-yl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]-4-iodobutan-1-one.
| Compound Name | 1-[6,7-dichloro-5-methyl-9-(1-methylpyrazol-3-yl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]-4-iodobutan-1-one |
|---|---|
| PubChem CID | 169147886 |
| Molecular Formula | C20H23Cl2IN4O |
| Molecular Weight | 533.24 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | 1-[6,7-dichloro-5-methyl-9-(1-methylpyrazol-3-yl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]-4-iodobutan-1-one |
| SMILES | CN1c2c(Cl)c(Cl)cc(-c3ccn(C)n3)c2C2CN(C(=O)CCCI)CCC21 |
| InChI | InChI=1S/C20H23Cl2IN4O/c1-25-8-5-15(24-25)12-10-14(21)19(22)20-18(12)13-11-27(17(28)4-3-7-23)9-6-16(13)26(20)2/h5,8,10,13,16H,3-4,6-7,9,11H2,1-2H3 |
| InChIKey | PBCHVCVHCSHONL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.24 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|