C8H10ClN3O — CID 169154520
3-amino-2-chloro-N,6-dimethylpyridine-4-carboxamide (PubChem CID 169154520) has the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. Its IUPAC name is 3-amino-2-chloro-N,6-dimethylpyridine-4-carboxamide.
| Compound Name | 3-amino-2-chloro-N,6-dimethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 169154520 |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 3-amino-2-chloro-N,6-dimethylpyridine-4-carboxamide |
| SMILES | CNC(=O)c1cc(C)nc(Cl)c1N |
| InChI | InChI=1S/C8H10ClN3O/c1-4-3-5(8(13)11-2)6(10)7(9)12-4/h3H,10H2,1-2H3,(H,11,13) |
| InChIKey | YFIMYEBNBGFCIW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|