C21H28N8OS — CID 169158071
8-(4-aminocyclohexyl)sulfinyl-N-(2-piperazin-1-yl-1H-imidazol-5-yl)quinazolin-2-amine (PubChem CID 169158071) has the molecular formula C21H28N8OS and a molecular weight of 440.58 g/mol. Its IUPAC name is 8-(4-aminocyclohexyl)sulfinyl-N-(2-piperazin-1-yl-1H-imidazol-5-yl)quinazolin-2-amine.
| Compound Name | 8-(4-aminocyclohexyl)sulfinyl-N-(2-piperazin-1-yl-1H-imidazol-5-yl)quinazolin-2-amine |
|---|---|
| PubChem CID | 169158071 |
| Molecular Formula | C21H28N8OS |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 8-(4-aminocyclohexyl)sulfinyl-N-(2-piperazin-1-yl-1H-imidazol-5-yl)quinazolin-2-amine |
| SMILES | NC1CCC(S(=O)c2cccc3cnc(Nc4cnc(N5CCNCC5)[nH]4)nc23)CC1 |
| InChI | InChI=1S/C21H28N8OS/c22-15-4-6-16(7-5-15)31(30)17-3-1-2-14-12-24-20(28-19(14)17)26-18-13-25-21(27-18)29-10-8-23-9-11-29/h1-3,12-13,15-16,23H,4-11,22H2,(H,25,27)(H,24,26,28) |
| InChIKey | CIPVBTUKQPLRIE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 124.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |