C15H17N5O — CID 169166626
(5-cyclopropyl-3,4-diazabicyclo[4.1.0]hepta-2,4-dien-2-yl)-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methanone (PubChem CID 169166626) has the molecular formula C15H17N5O and a molecular weight of 283.33 g/mol. Its IUPAC name is (5-cyclopropyl-3,4-diazabicyclo[4.1.0]hepta-2,4-dien-2-yl)-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methanone.
| Compound Name | (5-cyclopropyl-3,4-diazabicyclo[4.1.0]hepta-2,4-dien-2-yl)-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 169166626 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (5-cyclopropyl-3,4-diazabicyclo[4.1.0]hepta-2,4-dien-2-yl)-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methanone |
| SMILES | O=C(C1=NN=C(C2CC2)C2CC12)N1CCc2nc[nH]c2C1 |
| InChI | InChI=1S/C15H17N5O/c21-15(20-4-3-11-12(6-20)17-7-16-11)14-10-5-9(10)13(18-19-14)8-1-2-8/h7-10H,1-6H2,(H,16,17) |
| InChIKey | ZCHKXNZQSBCMPP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |