C10H11FN2O — CID 169172963
N-(5-fluoro-2,4-dimethyl-3-pyridinyl)prop-2-enamide (PubChem CID 169172963) has the molecular formula C10H11FN2O and a molecular weight of 194.21 g/mol. Its IUPAC name is N-(5-fluoro-2,4-dimethyl-3-pyridinyl)prop-2-enamide.
| Compound Name | N-(5-fluoro-2,4-dimethyl-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 169172963 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | N-(5-fluoro-2,4-dimethyl-3-pyridinyl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1c(C)ncc(F)c1C |
| InChI | InChI=1S/C10H11FN2O/c1-4-9(14)13-10-6(2)8(11)5-12-7(10)3/h4-5H,1H2,2-3H3,(H,13,14) |
| InChIKey | GCSXYCWOVKEISS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|