C18H15ClF2N4O — CID 176936789
N-[4-(5-chloro-2,4-dimethyl-3-pyridinyl)-1,7-difluoro-3-methylindazol-6-yl]prop-2-enamide (PubChem CID 176936789) has the molecular formula C18H15ClF2N4O and a molecular weight of 376.79 g/mol. Its IUPAC name is N-[4-(5-chloro-2,4-dimethyl-3-pyridinyl)-1,7-difluoro-3-methylindazol-6-yl]prop-2-enamide.
| Compound Name | N-[4-(5-chloro-2,4-dimethyl-3-pyridinyl)-1,7-difluoro-3-methylindazol-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 176936789 |
| Molecular Formula | C18H15ClF2N4O |
| Molecular Weight | 376.79 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[4-(5-chloro-2,4-dimethyl-3-pyridinyl)-1,7-difluoro-3-methylindazol-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(C)ncc(Cl)c2C)c2c(C)nn(F)c2c1F |
| InChI | InChI=1S/C18H15ClF2N4O/c1-5-14(26)23-13-6-11(15-8(2)12(19)7-22-9(15)3)16-10(4)24-25(21)18(16)17(13)20/h5-7H,1H2,2-4H3,(H,23,26) |
| InChIKey | OMGVRJBJBXMRHQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.79 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|