C17H12BrClIN3O — CID 156833676
N-[5-(5-bromo-4-chloro-2-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylphenyl]prop-2-enamide (PubChem CID 156833676) has the molecular formula C17H12BrClIN3O and a molecular weight of 516.56 g/mol. Its IUPAC name is N-[5-(5-bromo-4-chloro-2-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-(5-bromo-4-chloro-2-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156833676 |
| Molecular Formula | C17H12BrClIN3O |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 514.89 |
| IUPAC Name | N-[5-(5-bromo-4-chloro-2-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(I)[nH]c3ncc(Br)c(Cl)c23)ccc1C |
| InChI | InChI=1S/C17H12BrClIN3O/c1-3-12(24)22-11-6-9(5-4-8(11)2)13-14-15(19)10(18)7-21-17(14)23-16(13)20/h3-7H,1H2,2H3,(H,21,23)(H,22,24) |
| InChIKey | JGZBUJMFPIKPJP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|