C24H31N3O2Si — CID 156833832
N-[2-methyl-5-[5-(2-methylpropoxy)-2-trimethylsilyl-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]prop-2-enamide (PubChem CID 156833832) has the molecular formula C24H31N3O2Si and a molecular weight of 421.62 g/mol. Its IUPAC name is N-[2-methyl-5-[5-(2-methylpropoxy)-2-trimethylsilyl-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]prop-2-enamide.
| Compound Name | N-[2-methyl-5-[5-(2-methylpropoxy)-2-trimethylsilyl-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156833832 |
| Molecular Formula | C24H31N3O2Si |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N-[2-methyl-5-[5-(2-methylpropoxy)-2-trimethylsilyl-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c([Si](C)(C)C)[nH]c3ncc(OCC(C)C)cc23)ccc1C |
| InChI | InChI=1S/C24H31N3O2Si/c1-8-21(28)26-20-11-17(10-9-16(20)4)22-19-12-18(29-14-15(2)3)13-25-23(19)27-24(22)30(5,6)7/h8-13,15H,1,14H2,2-7H3,(H,25,27)(H,26,28) |
| InChIKey | OVFHTYDDGVQARQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|