C19H27N5O4 — CID 169174971
[(5R)-5-[(6Z)-5-amino-6-prop-2-enylidene-1,2,4-triazin-1-yl]-2-cyanooxolan-2-yl]methyl hexyl carbonate (PubChem CID 169174971) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is [(5R)-5-[(6Z)-5-amino-6-prop-2-enylidene-1,2,4-triazin-1-yl]-2-cyanooxolan-2-yl]methyl hexyl carbonate.
| Compound Name | [(5R)-5-[(6Z)-5-amino-6-prop-2-enylidene-1,2,4-triazin-1-yl]-2-cyanooxolan-2-yl]methyl hexyl carbonate |
|---|---|
| PubChem CID | 169174971 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | [(5R)-5-[(6Z)-5-amino-6-prop-2-enylidene-1,2,4-triazin-1-yl]-2-cyanooxolan-2-yl]methyl hexyl carbonate |
| SMILES | C=C/C=C1/C(N)=NC=NN1[C@H]1CCC(C#N)(COC(=O)OCCCCCC)O1 |
| InChI | InChI=1S/C19H27N5O4/c1-3-5-6-7-11-26-18(25)27-13-19(12-20)10-9-16(28-19)24-15(8-4-2)17(21)22-14-23-24/h4,8,14,16H,2-3,5-7,9-11,13H2,1H3,(H2,21,22,23)/b15-8-/t16-,19?/m1/s1 |
| InChIKey | GSJOCUBPHFKDNB-YTHCHIGUSA-N |
| XLogP | 2.80 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|