C36H35N2+ — CID 169180728
5-(3,5-diphenylphenyl)-2-(2,4,6-trimethylphenyl)imidazo[1,5-a]pyridin-2-ium;ethane (PubChem CID 169180728) has the molecular formula C36H35N2+ and a molecular weight of 495.69 g/mol. Its IUPAC name is 5-(3,5-diphenylphenyl)-2-(2,4,6-trimethylphenyl)imidazo[1,5-a]pyridin-2-ium;ethane.
| Compound Name | 5-(3,5-diphenylphenyl)-2-(2,4,6-trimethylphenyl)imidazo[1,5-a]pyridin-2-ium;ethane |
|---|---|
| PubChem CID | 169180728 |
| Molecular Formula | C36H35N2+ |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 5-(3,5-diphenylphenyl)-2-(2,4,6-trimethylphenyl)imidazo[1,5-a]pyridin-2-ium;ethane |
| SMILES | CC.Cc1cc(C)c(-[n+]2cc3cccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)n3c2)c(C)c1 |
| InChI | InChI=1S/C34H29N2.C2H6/c1-24-17-25(2)34(26(3)18-24)35-22-32-15-10-16-33(36(32)23-35)31-20-29(27-11-6-4-7-12-27)19-30(21-31)28-13-8-5-9-14-28;1-2/h4-23H,1-3H3;1-2H3/q+1; |
| InChIKey | VSCBWZIBDCADCS-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|