C14H12ClN3O2S2 — CID 169181732
4-[(3-chloro-1H-indol-7-yl)amino]sulfanylbenzenesulfonamide (PubChem CID 169181732) has the molecular formula C14H12ClN3O2S2 and a molecular weight of 353.86 g/mol. Its IUPAC name is 4-[(3-chloro-1H-indol-7-yl)amino]sulfanylbenzenesulfonamide.
| Compound Name | 4-[(3-chloro-1H-indol-7-yl)amino]sulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 169181732 |
| Molecular Formula | C14H12ClN3O2S2 |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 4-[(3-chloro-1H-indol-7-yl)amino]sulfanylbenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(SNc2cccc3c(Cl)c[nH]c23)cc1 |
| InChI | InChI=1S/C14H12ClN3O2S2/c15-12-8-17-14-11(12)2-1-3-13(14)18-21-9-4-6-10(7-5-9)22(16,19)20/h1-8,17-18H,(H2,16,19,20) |
| InChIKey | YRHFNRVSFJUVST-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|