C15H18ClN3OS — CID 177228565
3-chloro-N-[(2-ethyl-1,3-oxazol-5-yl)sulfanyl]-1H-indol-7-amine;ethane (PubChem CID 177228565) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is 3-chloro-N-[(2-ethyl-1,3-oxazol-5-yl)sulfanyl]-1H-indol-7-amine;ethane.
| Compound Name | 3-chloro-N-[(2-ethyl-1,3-oxazol-5-yl)sulfanyl]-1H-indol-7-amine;ethane |
|---|---|
| PubChem CID | 177228565 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-chloro-N-[(2-ethyl-1,3-oxazol-5-yl)sulfanyl]-1H-indol-7-amine;ethane |
| SMILES | CC.CCc1ncc(SNc2cccc3c(Cl)c[nH]c23)o1 |
| InChI | InChI=1S/C13H12ClN3OS.C2H6/c1-2-11-15-7-12(18-11)19-17-10-5-3-4-8-9(14)6-16-13(8)10;1-2/h3-7,16-17H,2H2,1H3;1-2H3 |
| InChIKey | YLHBEEOKBXVVEN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|